C21H19FN4O4S2 — CID 22584843
N-[2-[2-(4-fluorophenyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 22584843) has the molecular formula C21H19FN4O4S2 and a molecular weight of 474.54 g/mol. Its IUPAC name is N-[2-[2-(4-fluorophenyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[2-[2-(4-fluorophenyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 22584843 |
| Molecular Formula | C21H19FN4O4S2 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | N-[2-[2-(4-fluorophenyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | Cc1c(CCNS(=O)(=O)c2ccc3c(c2)OCCO3)sc2nc(-c3ccc(F)cc3)nn12 |
| InChI | InChI=1S/C21H19FN4O4S2/c1-13-19(31-21-24-20(25-26(13)21)14-2-4-15(22)5-3-14)8-9-23-32(27,28)16-6-7-17-18(12-16)30-11-10-29-17/h2-7,12,23H,8-11H2,1H3 |
| InChIKey | FLYJIXUWTUCYOT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |