C15H16N4O4S2 — CID 53163147
N-[(2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 53163147) has the molecular formula C15H16N4O4S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[(2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[(2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 53163147 |
| Molecular Formula | C15H16N4O4S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-[(2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | Cc1nn2c(CNS(=O)(=O)c3ccc4c(c3)OCCO4)c(C)nc2s1 |
| InChI | InChI=1S/C15H16N4O4S2/c1-9-12(19-15(17-9)24-10(2)18-19)8-16-25(20,21)11-3-4-13-14(7-11)23-6-5-22-13/h3-4,7,16H,5-6,8H2,1-2H3 |
| InChIKey | NHIQDBXTCWMVNA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |