C21H24N4OS — CID 22585757
4-(azepan-1-yl)-N-benzyl-5-methylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 22585757) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-benzyl-5-methylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-(azepan-1-yl)-N-benzyl-5-methylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 22585757 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-(azepan-1-yl)-N-benzyl-5-methylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccccc2)sc2ncnc(N3CCCCCC3)c12 |
| InChI | InChI=1S/C21H24N4OS/c1-15-17-19(25-11-7-2-3-8-12-25)23-14-24-21(17)27-18(15)20(26)22-13-16-9-5-4-6-10-16/h4-6,9-10,14H,2-3,7-8,11-13H2,1H3,(H,22,26) |
| InChIKey | HODWRSSSLYFMIK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |