C24H31N5OS — CID 46344866
5-methyl-N-(3-phenylpropyl)-4-(4-propylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 46344866) has the molecular formula C24H31N5OS and a molecular weight of 437.61 g/mol. Its IUPAC name is 5-methyl-N-(3-phenylpropyl)-4-(4-propylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-N-(3-phenylpropyl)-4-(4-propylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 46344866 |
| Molecular Formula | C24H31N5OS |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 5-methyl-N-(3-phenylpropyl)-4-(4-propylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCCN1CCN(c2ncnc3sc(C(=O)NCCCc4ccccc4)c(C)c23)CC1 |
| InChI | InChI=1S/C24H31N5OS/c1-3-12-28-13-15-29(16-14-28)22-20-18(2)21(31-24(20)27-17-26-22)23(30)25-11-7-10-19-8-5-4-6-9-19/h4-6,8-9,17H,3,7,10-16H2,1-2H3,(H,25,30) |
| InChIKey | PEWBFBUKKKTIOR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|