C26H35N7OS — CID 46344718
5-methyl-4-(4-methylpiperazin-1-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 46344718) has the molecular formula C26H35N7OS and a molecular weight of 493.68 g/mol. Its IUPAC name is 5-methyl-4-(4-methylpiperazin-1-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-4-(4-methylpiperazin-1-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 46344718 |
| Molecular Formula | C26H35N7OS |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 5-methyl-4-(4-methylpiperazin-1-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCCCN2CCN(c3ccccc3)CC2)sc2ncnc(N3CCN(C)CC3)c12 |
| InChI | InChI=1S/C26H35N7OS/c1-20-22-24(33-15-11-30(2)12-16-33)28-19-29-26(22)35-23(20)25(34)27-9-6-10-31-13-17-32(18-14-31)21-7-4-3-5-8-21/h3-5,7-8,19H,6,9-18H2,1-2H3,(H,27,34) |
| InChIKey | ADMPIEQKSLVJNN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|