C16H23N5O2S — CID 46344626
N-(2-methoxyethyl)-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 46344626) has the molecular formula C16H23N5O2S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-(2-methoxyethyl)-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 46344626 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-(2-methoxyethyl)-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | COCCNC(=O)c1sc2ncnc(N3CCN(C)CC3)c2c1C |
| InChI | InChI=1S/C16H23N5O2S/c1-11-12-14(21-7-5-20(2)6-8-21)18-10-19-16(12)24-13(11)15(22)17-4-9-23-3/h10H,4-9H2,1-3H3,(H,17,22) |
| InChIKey | ATSDQIQHNJLFNN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|