C23H30N6OS — CID 46344750
5-methyl-N-[3-(N-methylanilino)propyl]-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 46344750) has the molecular formula C23H30N6OS and a molecular weight of 438.60 g/mol. Its IUPAC name is 5-methyl-N-[3-(N-methylanilino)propyl]-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-N-[3-(N-methylanilino)propyl]-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 46344750 |
| Molecular Formula | C23H30N6OS |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 5-methyl-N-[3-(N-methylanilino)propyl]-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCCCN(C)c2ccccc2)sc2ncnc(N3CCN(C)CC3)c12 |
| InChI | InChI=1S/C23H30N6OS/c1-17-19-21(29-14-12-27(2)13-15-29)25-16-26-23(19)31-20(17)22(30)24-10-7-11-28(3)18-8-5-4-6-9-18/h4-6,8-9,16H,7,10-15H2,1-3H3,(H,24,30) |
| InChIKey | BUEQFOCSUKRUCF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|