C27H31N5O4S — CID 22589528
N-butyl-3-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-3-oxo-2H-imidazo[1,2-c]quinazolin-2-yl]propanamide (PubChem CID 22589528) has the molecular formula C27H31N5O4S and a molecular weight of 521.64 g/mol. Its IUPAC name is N-butyl-3-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-3-oxo-2H-imidazo[1,2-c]quinazolin-2-yl]propanamide.
| Compound Name | N-butyl-3-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-3-oxo-2H-imidazo[1,2-c]quinazolin-2-yl]propanamide |
|---|---|
| PubChem CID | 22589528 |
| Molecular Formula | C27H31N5O4S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | N-butyl-3-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-3-oxo-2H-imidazo[1,2-c]quinazolin-2-yl]propanamide |
| SMILES | CCCCNC(=O)CCC1N=C2c3ccccc3N=C(SCC(=O)Nc3ccc(OCC)cc3)N2C1=O |
| InChI | InChI=1S/C27H31N5O4S/c1-3-5-16-28-23(33)15-14-22-26(35)32-25(30-22)20-8-6-7-9-21(20)31-27(32)37-17-24(34)29-18-10-12-19(13-11-18)36-4-2/h6-13,22H,3-5,14-17H2,1-2H3,(H,28,33)(H,29,34) |
| InChIKey | UCOOZSWDBWDRTL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 112.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|