C26H29N5O4S — CID 92694463
N-butyl-3-[(2R)-5-[2-(2-methoxyanilino)-2-oxoethyl]sulfanyl-3-oxo-2H-imidazo[1,2-c]quinazolin-2-yl]propanamide (PubChem CID 92694463) has the molecular formula C26H29N5O4S and a molecular weight of 507.62 g/mol. Its IUPAC name is N-butyl-3-[(2R)-5-[2-(2-methoxyanilino)-2-oxoethyl]sulfanyl-3-oxo-2H-imidazo[1,2-c]quinazolin-2-yl]propanamide.
| Compound Name | N-butyl-3-[(2R)-5-[2-(2-methoxyanilino)-2-oxoethyl]sulfanyl-3-oxo-2H-imidazo[1,2-c]quinazolin-2-yl]propanamide |
|---|---|
| PubChem CID | 92694463 |
| Molecular Formula | C26H29N5O4S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | N-butyl-3-[(2R)-5-[2-(2-methoxyanilino)-2-oxoethyl]sulfanyl-3-oxo-2H-imidazo[1,2-c]quinazolin-2-yl]propanamide |
| SMILES | CCCCNC(=O)CC[C@H]1N=C2c3ccccc3N=C(SCC(=O)Nc3ccccc3OC)N2C1=O |
| InChI | InChI=1S/C26H29N5O4S/c1-3-4-15-27-22(32)14-13-20-25(34)31-24(29-20)17-9-5-6-10-18(17)30-26(31)36-16-23(33)28-19-11-7-8-12-21(19)35-2/h5-12,20H,3-4,13-16H2,1-2H3,(H,27,32)(H,28,33)/t20-/m1/s1 |
| InChIKey | XSAMOWJRLPQXFL-HXUWFJFHSA-N |
| XLogP | 3.72 |
| TPSA | 112.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|