C27H31N5O3S — CID 92657551
N-butyl-2-[(2S)-3-oxo-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-2H-imidazo[1,2-c]quinazolin-2-yl]acetamide (PubChem CID 92657551) has the molecular formula C27H31N5O3S and a molecular weight of 505.64 g/mol. Its IUPAC name is N-butyl-2-[(2S)-3-oxo-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-2H-imidazo[1,2-c]quinazolin-2-yl]acetamide.
| Compound Name | N-butyl-2-[(2S)-3-oxo-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-2H-imidazo[1,2-c]quinazolin-2-yl]acetamide |
|---|---|
| PubChem CID | 92657551 |
| Molecular Formula | C27H31N5O3S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-butyl-2-[(2S)-3-oxo-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-2H-imidazo[1,2-c]quinazolin-2-yl]acetamide |
| SMILES | CCCCNC(=O)C[C@@H]1N=C2c3ccccc3N=C(SCC(=O)Nc3c(C)cc(C)cc3C)N2C1=O |
| InChI | InChI=1S/C27H31N5O3S/c1-5-6-11-28-22(33)14-21-26(35)32-25(29-21)19-9-7-8-10-20(19)30-27(32)36-15-23(34)31-24-17(3)12-16(2)13-18(24)4/h7-10,12-13,21H,5-6,11,14-15H2,1-4H3,(H,28,33)(H,31,34)/t21-/m0/s1 |
| InChIKey | PRZSGMBBKOVSAC-NRFANRHFSA-N |
| XLogP | 4.25 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|