C22H14BrFN4O2S2 — CID 22590039
12-(4-bromophenyl)-N-(4-fluorophenyl)-4-methyl-2-oxo-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraene-5-carboxamide (PubChem CID 22590039) has the molecular formula C22H14BrFN4O2S2 and a molecular weight of 529.42 g/mol. Its IUPAC name is 12-(4-bromophenyl)-N-(4-fluorophenyl)-4-methyl-2-oxo-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraene-5-carboxamide.
| Compound Name | 12-(4-bromophenyl)-N-(4-fluorophenyl)-4-methyl-2-oxo-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 22590039 |
| Molecular Formula | C22H14BrFN4O2S2 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 527.97 |
| IUPAC Name | 12-(4-bromophenyl)-N-(4-fluorophenyl)-4-methyl-2-oxo-6,10-dithia-1,8,13-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,12-tetraene-5-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(F)cc2)sc2nc3n(c(=O)c12)N=C(c1ccc(Br)cc1)CS3 |
| InChI | InChI=1S/C22H14BrFN4O2S2/c1-11-17-20(32-18(11)19(29)25-15-8-6-14(24)7-9-15)26-22-28(21(17)30)27-16(10-31-22)12-2-4-13(23)5-3-12/h2-9H,10H2,1H3,(H,25,29) |
| InChIKey | UHZVGOLXSVPIPR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |