C21H15ClN2O — CID 2259107
3-[(4-chlorophenyl)methyl]-5-(4-phenylphenyl)-1,2,4-oxadiazole (PubChem CID 2259107) has the molecular formula C21H15ClN2O and a molecular weight of 346.82 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-5-(4-phenylphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-[(4-chlorophenyl)methyl]-5-(4-phenylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 2259107 |
| Molecular Formula | C21H15ClN2O |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-5-(4-phenylphenyl)-1,2,4-oxadiazole |
| SMILES | Clc1ccc(Cc2noc(-c3ccc(-c4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C21H15ClN2O/c22-19-12-6-15(7-13-19)14-20-23-21(25-24-20)18-10-8-17(9-11-18)16-4-2-1-3-5-16/h1-13H,14H2 |
| InChIKey | JWNLJTVZTQVWFS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |