methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate

C19H13NO3S — CID 22591974

IUPACmethyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate
SMILESCOC(=O)C(=O)c1cn(-c2csc3ccccc23)c2ccccc12
InChIInChI=1S/C19H13NO3S/c1-23-19(22)18(21)14-10-20(15-8-4-2-6-12(14)15)16-11-24-17-9-5-3-7-13(16)17/h2-11H,1H3
InChIKeyCDZQGDJNKBBFHZ-UHFFFAOYSA-N
MW335.38 g/mol
LogP4.20
Rot. Bonds3

About methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate

methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate (PubChem CID 22591974) has the molecular formula C19H13NO3S and a molecular weight of 335.38 g/mol. Its IUPAC name is methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate.

Molecular Properties

Compound Namemethyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate
PubChem CID22591974
Molecular FormulaC19H13NO3S
Molecular Weight335.38 g/mol
Exact Mass335.06
IUPAC Namemethyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate
SMILESCOC(=O)C(=O)c1cn(-c2csc3ccccc23)c2ccccc12
InChIInChI=1S/C19H13NO3S/c1-23-19(22)18(21)14-10-20(15-8-4-2-6-12(14)15)16-11-24-17-9-5-3-7-13(16)17/h2-11H,1H3
InChIKeyCDZQGDJNKBBFHZ-UHFFFAOYSA-N
XLogP4.20
TPSA48.30 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500335.38
LogP ≤ 54.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate?
The IUPAC name of methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate (CID 22591974) is methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate.
What is the SMILES notation for methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate?
The canonical SMILES for methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate is COC(=O)C(=O)c1cn(-c2csc3ccccc23)c2ccccc12.
What is the InChIKey of methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate?
The InChIKey is CDZQGDJNKBBFHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO3S/c1-23-19(22)18(21)14-10-20(15-8-4-2-6-12(14)15)16-11-24-17-9-5-3-7-13(16)17/h2-11H,1H3.
What are the key properties of methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate?
methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate has a molecular weight of 335.38 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(1-benzothiophen-3-yl)indol-3-yl]-2-oxoacetate is sourced from PubChem (CID 22591974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).