C16H22ClN — CID 22593672
2-(1H-inden-2-ylmethyl)-1-methylpiperidine;hydrochloride (PubChem CID 22593672) has the molecular formula C16H22ClN and a molecular weight of 263.81 g/mol. Its IUPAC name is 2-(1H-inden-2-ylmethyl)-1-methylpiperidine;hydrochloride.
| Compound Name | 2-(1H-inden-2-ylmethyl)-1-methylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 22593672 |
| Molecular Formula | C16H22ClN |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-(1H-inden-2-ylmethyl)-1-methylpiperidine;hydrochloride |
| SMILES | CN1CCCCC1CC1=Cc2ccccc2C1.Cl |
| InChI | InChI=1S/C16H21N.ClH/c1-17-9-5-4-8-16(17)12-13-10-14-6-2-3-7-15(14)11-13;/h2-3,6-7,10,16H,4-5,8-9,11-12H2,1H3;1H |
| InChIKey | KLCMRWZQRZQGDR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |