C11H22N4O2 — CID 22594321
tert-butyl N-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]carbamate (PubChem CID 22594321) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl N-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 22594321 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | tert-butyl N-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC1=NCCN1 |
| InChI | InChI=1S/C11H22N4O2/c1-11(2,3)17-10(16)15-6-4-5-12-9-13-7-8-14-9/h4-8H2,1-3H3,(H,15,16)(H2,12,13,14) |
| InChIKey | WZPYCRFNVFGRRA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|