C11H22N4O3 — CID 11694555
tert-butyl (NE)-N-[amino-(2-methylpropylcarbamoylamino)methylidene]carbamate (PubChem CID 11694555) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is tert-butyl (NE)-N-[amino-(2-methylpropylcarbamoylamino)methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[amino-(2-methylpropylcarbamoylamino)methylidene]carbamate |
|---|---|
| PubChem CID | 11694555 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | tert-butyl (NE)-N-[amino-(2-methylpropylcarbamoylamino)methylidene]carbamate |
| SMILES | CC(C)CNC(=O)N/C(N)=N/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N4O3/c1-7(2)6-13-9(16)14-8(12)15-10(17)18-11(3,4)5/h7H,6H2,1-5H3,(H4,12,13,14,15,16,17) |
| InChIKey | WTVWTEAABSRBKB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|