C10H20N4O3 — CID 54182627
methyl N-[dimethylamino-[methyl(propylcarbamoyl)amino]methylidene]carbamate (PubChem CID 54182627) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is methyl N-[dimethylamino-[methyl(propylcarbamoyl)amino]methylidene]carbamate.
| Compound Name | methyl N-[dimethylamino-[methyl(propylcarbamoyl)amino]methylidene]carbamate |
|---|---|
| PubChem CID | 54182627 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | methyl N-[dimethylamino-[methyl(propylcarbamoyl)amino]methylidene]carbamate |
| SMILES | CCCNC(=O)N(C)C(=NC(=O)OC)N(C)C |
| InChI | InChI=1S/C10H20N4O3/c1-6-7-11-9(15)14(4)8(13(2)3)12-10(16)17-5/h6-7H2,1-5H3,(H,11,15) |
| InChIKey | PCWPVWBAASTWEZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|