C15H30F3IN4O2 — CID 109474150
tert-butyl N-methyl-N-[2-methyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 109474150) has the molecular formula C15H30F3IN4O2 and a molecular weight of 482.33 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-methyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-methyl-N-[2-methyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109474150 |
| Molecular Formula | C15H30F3IN4O2 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | tert-butyl N-methyl-N-[2-methyl-3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC(C)CN(C)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C15H29F3N4O2.HI/c1-11(10-22(6)13(23)24-14(2,3)4)9-21-12(19-5)20-8-7-15(16,17)18;/h11H,7-10H2,1-6H3,(H2,19,20,21);1H |
| InChIKey | NPYUMCUWLVLFKC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|