C13H24F3IN4O2 — CID 109466763
tert-butyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109466763) has the molecular formula C13H24F3IN4O2 and a molecular weight of 452.26 g/mol. Its IUPAC name is tert-butyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109466763 |
| Molecular Formula | C13H24F3IN4O2 |
| Molecular Weight | 452.26 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | tert-butyl 3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C13H23F3N4O2.HI/c1-12(2,3)22-11(21)20-7-9(8-20)19-10(17-4)18-6-5-13(14,15)16;/h9H,5-8H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | LYEQVYPQYVELAA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|