C16H30F3IN4O3 — CID 109465347
tert-butyl 3-[[N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109465347) has the molecular formula C16H30F3IN4O3 and a molecular weight of 510.34 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109465347 |
| Molecular Formula | C16H30F3IN4O3 |
| Molecular Weight | 510.34 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC(F)(F)F)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C16H29F3N4O3.HI/c1-5-20-13(21-7-6-8-25-11-16(17,18)19)22-12-9-23(10-12)14(24)26-15(2,3)4;/h12H,5-11H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | BGSJLZCXZOLUPJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|