C14H27FN4O2 — CID 109466162
tert-butyl 3-[[N-ethyl-N'-(3-fluoropropyl)carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109466162) has the molecular formula C14H27FN4O2 and a molecular weight of 302.39 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-(3-fluoropropyl)carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-(3-fluoropropyl)carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109466162 |
| Molecular Formula | C14H27FN4O2 |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-(3-fluoropropyl)carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | CCN/C(=N\CCCF)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H27FN4O2/c1-5-16-12(17-8-6-7-15)18-11-9-19(10-11)13(20)21-14(2,3)4/h11H,5-10H2,1-4H3,(H2,16,17,18) |
| InChIKey | JLZCHSWAJVIGSR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|