C17H34F3IN4O2 — CID 109412372
tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]pentan-3-yl]carbamate;hydroiodide (PubChem CID 109412372) has the molecular formula C17H34F3IN4O2 and a molecular weight of 510.38 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]pentan-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]pentan-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109412372 |
| Molecular Formula | C17H34F3IN4O2 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]pentan-3-yl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C.I |
| InChI | InChI=1S/C17H33F3N4O2.HI/c1-12(2)13(23-15(25)26-16(3,4)5)8-11-24(7)14(21-6)22-10-9-17(18,19)20;/h12-13H,8-11H2,1-7H3,(H,21,22)(H,23,25);1H |
| InChIKey | HRTRSJYRWRHUQG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|