C19H37F3N4O3 — CID 109412152
tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]amino]pentan-3-yl]carbamate (PubChem CID 109412152) has the molecular formula C19H37F3N4O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]amino]pentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]amino]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 109412152 |
| Molecular Formula | C19H37F3N4O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]amino]pentan-3-yl]carbamate |
| SMILES | C/N=C(\NCCCOCC(F)(F)F)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C19H37F3N4O3/c1-14(2)15(25-17(27)29-18(3,4)5)9-11-26(7)16(23-6)24-10-8-12-28-13-19(20,21)22/h14-15H,8-13H2,1-7H3,(H,23,24)(H,25,27) |
| InChIKey | YBAQCUSHKSSPHP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|