C17H34F2N4O2 — CID 109412449
tert-butyl N-[1-[[N'-(2,2-difluoroethyl)-N-ethylcarbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate (PubChem CID 109412449) has the molecular formula C17H34F2N4O2 and a molecular weight of 364.48 g/mol. Its IUPAC name is tert-butyl N-[1-[[N'-(2,2-difluoroethyl)-N-ethylcarbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[N'-(2,2-difluoroethyl)-N-ethylcarbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate |
|---|---|
| PubChem CID | 109412449 |
| Molecular Formula | C17H34F2N4O2 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | tert-butyl N-[1-[[N'-(2,2-difluoroethyl)-N-ethylcarbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate |
| SMILES | CCN/C(=N\CC(F)F)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H34F2N4O2/c1-8-20-15(21-11-14(18)19)23(7)10-9-13(12(2)3)22-16(24)25-17(4,5)6/h12-14H,8-11H2,1-7H3,(H,20,21)(H,22,24) |
| InChIKey | CBMCOOOQUYLDMP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|