C20H39F2N5O2 — CID 109394982
tert-butyl N-[2-[[[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate (PubChem CID 109394982) has the molecular formula C20H39F2N5O2 and a molecular weight of 419.56 g/mol. Its IUPAC name is tert-butyl N-[2-[[[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[[[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 109394982 |
| Molecular Formula | C20H39F2N5O2 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | tert-butyl N-[2-[[[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CC/N=C(\NCC)NC1CCN(CC(F)F)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H39F2N5O2/c1-6-11-27(19(28)29-20(3,4)5)14-10-24-18(23-7-2)25-16-8-12-26(13-9-16)15-17(21)22/h16-17H,6-15H2,1-5H3,(H2,23,24,25) |
| InChIKey | KCTOBLQUXLJYAO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|