C15H30N4O4 — CID 57011919
tert-butyl N-(4-aminobutyl)-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 57011919) has the molecular formula C15H30N4O4 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl N-(4-aminobutyl)-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-(4-aminobutyl)-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 57011919 |
| Molecular Formula | C15H30N4O4 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | tert-butyl N-(4-aminobutyl)-N-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(N)N(CCCCN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N4O4/c1-14(2,3)22-12(20)18-11(17)19(10-8-7-9-16)13(21)23-15(4,5)6/h7-10,16H2,1-6H3,(H2,17,18,20) |
| InChIKey | HTQYAGXQSYEOLA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|