C20H20ClF5N2O2 — CID 22597764
4-methoxy-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-3-(1,1,2,2,2-pentafluoroethyl)benzamide;hydrochloride (PubChem CID 22597764) has the molecular formula C20H20ClF5N2O2 and a molecular weight of 450.84 g/mol. Its IUPAC name is 4-methoxy-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-3-(1,1,2,2,2-pentafluoroethyl)benzamide;hydrochloride.
| Compound Name | 4-methoxy-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-3-(1,1,2,2,2-pentafluoroethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 22597764 |
| Molecular Formula | C20H20ClF5N2O2 |
| Molecular Weight | 450.84 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 4-methoxy-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-3-(1,1,2,2,2-pentafluoroethyl)benzamide;hydrochloride |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(c2)CN(C)CC3)cc1C(F)(F)C(F)(F)F.Cl |
| InChI | InChI=1S/C20H19F5N2O2.ClH/c1-27-8-7-12-3-5-15(9-14(12)11-27)26-18(28)13-4-6-17(29-2)16(10-13)19(21,22)20(23,24)25;/h3-6,9-10H,7-8,11H2,1-2H3,(H,26,28);1H |
| InChIKey | JXHNDDUHESZSSC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.84 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|