C25H23IN2O3 — CID 22597775
5-benzoyl-N-(7-iodo-2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)-2-methoxybenzamide (PubChem CID 22597775) has the molecular formula C25H23IN2O3 and a molecular weight of 526.37 g/mol. Its IUPAC name is 5-benzoyl-N-(7-iodo-2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)-2-methoxybenzamide.
| Compound Name | 5-benzoyl-N-(7-iodo-2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 22597775 |
| Molecular Formula | C25H23IN2O3 |
| Molecular Weight | 526.37 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | 5-benzoyl-N-(7-iodo-2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)-2-methoxybenzamide |
| SMILES | COc1ccc(C(=O)c2ccccc2)cc1C(=O)Nc1cc(I)cc2c1CCN(C)C2 |
| InChI | InChI=1S/C25H23IN2O3/c1-28-11-10-20-18(15-28)12-19(26)14-22(20)27-25(30)21-13-17(8-9-23(21)31-2)24(29)16-6-4-3-5-7-16/h3-9,12-14H,10-11,15H2,1-2H3,(H,27,30) |
| InChIKey | PMRSETIJSQHJTO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|