C20H27N5O — CID 22603175
N-(1-azidobutan-2-yl)-3,6-dimethyl-2-(2,4,6-trimethylphenoxy)pyridin-4-amine (PubChem CID 22603175) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is N-(1-azidobutan-2-yl)-3,6-dimethyl-2-(2,4,6-trimethylphenoxy)pyridin-4-amine.
| Compound Name | N-(1-azidobutan-2-yl)-3,6-dimethyl-2-(2,4,6-trimethylphenoxy)pyridin-4-amine |
|---|---|
| PubChem CID | 22603175 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | N-(1-azidobutan-2-yl)-3,6-dimethyl-2-(2,4,6-trimethylphenoxy)pyridin-4-amine |
| SMILES | CCC(CN=[N+]=[N-])Nc1cc(C)nc(Oc2c(C)cc(C)cc2C)c1C |
| InChI | InChI=1S/C20H27N5O/c1-7-17(11-22-25-21)24-18-10-15(5)23-20(16(18)6)26-19-13(3)8-12(2)9-14(19)4/h8-10,17H,7,11H2,1-6H3,(H,23,24) |
| InChIKey | OZEQVNWOFOTTCW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|