C12H14O4S — CID 22603272
methyl 2-[(5-methyl-7-sulfanyl-2,3-dihydro-1-benzofuran-4-yl)oxy]acetate (PubChem CID 22603272) has the molecular formula C12H14O4S and a molecular weight of 254.31 g/mol. Its IUPAC name is methyl 2-[(5-methyl-7-sulfanyl-2,3-dihydro-1-benzofuran-4-yl)oxy]acetate.
| Compound Name | methyl 2-[(5-methyl-7-sulfanyl-2,3-dihydro-1-benzofuran-4-yl)oxy]acetate |
|---|---|
| PubChem CID | 22603272 |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | methyl 2-[(5-methyl-7-sulfanyl-2,3-dihydro-1-benzofuran-4-yl)oxy]acetate |
| SMILES | COC(=O)COc1c(C)cc(S)c2c1CCO2 |
| InChI | InChI=1S/C12H14O4S/c1-7-5-9(17)12-8(3-4-15-12)11(7)16-6-10(13)14-2/h5,17H,3-4,6H2,1-2H3 |
| InChIKey | APRHIOPDEBBCPX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|