About octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol
octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol (PubChem CID 22605132) has the molecular formula C18H30O4S2
and a molecular weight of 374.57 g/mol. Its IUPAC name is octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol.
Molecular Properties
| Compound Name | octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol |
| PubChem CID | 22605132 |
| Molecular Formula | C18H30O4S2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol |
| SMILES | CCCCCCCCS(=O)(=O)[O-].Oc1ccc([S+]2CCCC2)cc1 |
| InChI | InChI=1S/C10H12OS.C8H18O3S/c11-9-3-5-10(6-4-9)12-7-1-2-8-12;1-2-3-4-5-6-7-8-12(9,10)11/h3-6H,1-2,7-8H2;2-8H2,1H3,(H,9,10,11) |
| InChIKey | PIBMBUWFIODVRL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol?
The IUPAC name of octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol (CID 22605132) is octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol.
What is the SMILES notation for octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol?
The canonical SMILES for octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol is CCCCCCCCS(=O)(=O)[O-].Oc1ccc([S+]2CCCC2)cc1.
What is the InChIKey of octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol?
The InChIKey is PIBMBUWFIODVRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS.C8H18O3S/c11-9-3-5-10(6-4-9)12-7-1-2-8-12;1-2-3-4-5-6-7-8-12(9,10)11/h3-6H,1-2,7-8H2;2-8H2,1H3,(H,9,10,11).
What are the key properties of octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol?
octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol has a molecular weight of 374.57 g/mol, XLogP of 4.06, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for octane-1-sulfonate;4-(thiolan-1-ium-1-yl)phenol is sourced from PubChem (CID 22605132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).