C9H12N4O3 — CID 22605324
5-methyl-3-nitro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carboxamide (PubChem CID 22605324) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 5-methyl-3-nitro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carboxamide.
| Compound Name | 5-methyl-3-nitro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 22605324 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 5-methyl-3-nitro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carboxamide |
| SMILES | CC1CCn2nc(C(N)=O)c([N+](=O)[O-])c2C1 |
| InChI | InChI=1S/C9H12N4O3/c1-5-2-3-12-6(4-5)8(13(15)16)7(11-12)9(10)14/h5H,2-4H2,1H3,(H2,10,14) |
| InChIKey | KTEOACUOVFEERW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|