C19H21N3O2 — CID 22605795
[5-(4-butoxyphenyl)-3,4-dihydropyrazol-2-yl]-pyridin-3-ylmethanone (PubChem CID 22605795) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is [5-(4-butoxyphenyl)-3,4-dihydropyrazol-2-yl]-pyridin-3-ylmethanone.
| Compound Name | [5-(4-butoxyphenyl)-3,4-dihydropyrazol-2-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 22605795 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [5-(4-butoxyphenyl)-3,4-dihydropyrazol-2-yl]-pyridin-3-ylmethanone |
| SMILES | CCCCOc1ccc(C2=NN(C(=O)c3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C19H21N3O2/c1-2-3-13-24-17-8-6-15(7-9-17)18-10-12-22(21-18)19(23)16-5-4-11-20-14-16/h4-9,11,14H,2-3,10,12-13H2,1H3 |
| InChIKey | OPNUZRTXUCQBQO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|