C17H15N3O3 — CID 22612035
N-[(5-methylfuran-2-yl)methyl]-2-pyridin-3-yloxypyridine-3-carboxamide (PubChem CID 22612035) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is N-[(5-methylfuran-2-yl)methyl]-2-pyridin-3-yloxypyridine-3-carboxamide.
| Compound Name | N-[(5-methylfuran-2-yl)methyl]-2-pyridin-3-yloxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 22612035 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[(5-methylfuran-2-yl)methyl]-2-pyridin-3-yloxypyridine-3-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2cccnc2Oc2cccnc2)o1 |
| InChI | InChI=1S/C17H15N3O3/c1-12-6-7-14(22-12)11-20-16(21)15-5-3-9-19-17(15)23-13-4-2-8-18-10-13/h2-10H,11H2,1H3,(H,20,21) |
| InChIKey | WEWVOVAVLDQETI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |