C16H20N4O2 — CID 95286023
N-[(2S)-2-(dimethylamino)propyl]-2-pyridin-3-yloxypyridine-3-carboxamide (PubChem CID 95286023) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[(2S)-2-(dimethylamino)propyl]-2-pyridin-3-yloxypyridine-3-carboxamide.
| Compound Name | N-[(2S)-2-(dimethylamino)propyl]-2-pyridin-3-yloxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 95286023 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[(2S)-2-(dimethylamino)propyl]-2-pyridin-3-yloxypyridine-3-carboxamide |
| SMILES | C[C@@H](CNC(=O)c1cccnc1Oc1cccnc1)N(C)C |
| InChI | InChI=1S/C16H20N4O2/c1-12(20(2)3)10-19-15(21)14-7-5-9-18-16(14)22-13-6-4-8-17-11-13/h4-9,11-12H,10H2,1-3H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | UBDKZOACNRURMC-LBPRGKRZSA-N |
| XLogP | 1.95 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |