C18H12ClN3O2S — CID 22612427
N-[(5-chlorothiophen-2-yl)methyl]-2-(3-cyanophenoxy)pyridine-3-carboxamide (PubChem CID 22612427) has the molecular formula C18H12ClN3O2S and a molecular weight of 369.83 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-(3-cyanophenoxy)pyridine-3-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(3-cyanophenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22612427 |
| Molecular Formula | C18H12ClN3O2S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(3-cyanophenoxy)pyridine-3-carboxamide |
| SMILES | N#Cc1cccc(Oc2ncccc2C(=O)NCc2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C18H12ClN3O2S/c19-16-7-6-14(25-16)11-22-17(23)15-5-2-8-21-18(15)24-13-4-1-3-12(9-13)10-20/h1-9H,11H2,(H,22,23) |
| InChIKey | ZCBQXKPIBUSXKP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |