C10H11N3O — CID 22613946
N-phenyl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 22613946) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is N-phenyl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | N-phenyl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 22613946 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N-phenyl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCC=N1 |
| InChI | InChI=1S/C10H11N3O/c14-10(13-8-4-7-11-13)12-9-5-2-1-3-6-9/h1-3,5-7H,4,8H2,(H,12,14) |
| InChIKey | GAIDMFJMNWIBCX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |