About 5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide
5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide (PubChem CID 22616311) has the molecular formula C16H12BrCl2F3N2O
and a molecular weight of 456.09 g/mol. Its IUPAC name is 5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide.
Molecular Properties
| Compound Name | 5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide |
| PubChem CID | 22616311 |
| Molecular Formula | C16H12BrCl2F3N2O |
| Molecular Weight | 456.09 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | 5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide |
| SMILES | Br.[H]/N=C1/c2cc(Cl)c(Cl)cc2CN1Cc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H11Cl2F3N2O.BrH/c17-12-5-10-8-23(15(22)11(10)6-13(12)18)7-9-3-1-2-4-14(9)24-16(19,20)21;/h1-6,22H,7-8H2;1H/b22-15-; |
| InChIKey | DTTSHWNVZFLXIY-YNYSCKANSA-N |
| XLogP | 5.81 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.09 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide?
The IUPAC name of 5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide (CID 22616311) is 5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide.
What is the SMILES notation for 5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide?
The canonical SMILES for 5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide is Br.[H]/N=C1/c2cc(Cl)c(Cl)cc2CN1Cc1ccccc1OC(F)(F)F.
What is the InChIKey of 5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide?
The InChIKey is DTTSHWNVZFLXIY-YNYSCKANSA-N. The full InChI is InChI=1S/C16H11Cl2F3N2O.BrH/c17-12-5-10-8-23(15(22)11(10)6-13(12)18)7-9-3-1-2-4-14(9)24-16(19,20)21;/h1-6,22H,7-8H2;1H/b22-15-;.
What are the key properties of 5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide?
5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide has a molecular weight of 456.09 g/mol, XLogP of 5.81, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-2-[[2-(trifluoromethoxy)phenyl]methyl]-3H-isoindol-1-imine;hydrobromide is sourced from PubChem (CID 22616311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).