C19H17N3O4 — CID 22618157
benzyl N-[3-(2,4-dioxo-1H-pyrimidin-6-yl)phenyl]-N-methylcarbamate (PubChem CID 22618157) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is benzyl N-[3-(2,4-dioxo-1H-pyrimidin-6-yl)phenyl]-N-methylcarbamate.
| Compound Name | benzyl N-[3-(2,4-dioxo-1H-pyrimidin-6-yl)phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 22618157 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | benzyl N-[3-(2,4-dioxo-1H-pyrimidin-6-yl)phenyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCc1ccccc1)c1cccc(-c2cc(=O)[nH]c(=O)[nH]2)c1 |
| InChI | InChI=1S/C19H17N3O4/c1-22(19(25)26-12-13-6-3-2-4-7-13)15-9-5-8-14(10-15)16-11-17(23)21-18(24)20-16/h2-11H,12H2,1H3,(H2,20,21,23,24) |
| InChIKey | KOJUMDXPFJKKRF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |