C32H22ClF2O2S2+ — CID 22619566
[4-[2-chloro-4-(4-methoxybenzoyl)phenyl]sulfanylphenyl]-bis(4-fluorophenyl)sulfanium (PubChem CID 22619566) has the molecular formula C32H22ClF2O2S2+ and a molecular weight of 576.11 g/mol. Its IUPAC name is [4-[2-chloro-4-(4-methoxybenzoyl)phenyl]sulfanylphenyl]-bis(4-fluorophenyl)sulfanium.
| Compound Name | [4-[2-chloro-4-(4-methoxybenzoyl)phenyl]sulfanylphenyl]-bis(4-fluorophenyl)sulfanium |
|---|---|
| PubChem CID | 22619566 |
| Molecular Formula | C32H22ClF2O2S2+ |
| Molecular Weight | 576.11 g/mol |
| Exact Mass | 575.07 |
| IUPAC Name | [4-[2-chloro-4-(4-methoxybenzoyl)phenyl]sulfanylphenyl]-bis(4-fluorophenyl)sulfanium |
| SMILES | COc1ccc(C(=O)c2ccc(Sc3ccc([S+](c4ccc(F)cc4)c4ccc(F)cc4)cc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C32H22ClF2O2S2/c1-37-25-9-2-21(3-10-25)32(36)22-4-19-31(30(33)20-22)38-26-11-17-29(18-12-26)39(27-13-5-23(34)6-14-27)28-15-7-24(35)8-16-28/h2-20H,1H3/q+1 |
| InChIKey | SMKKXKFPPMKTBJ-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.11 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|