C33H23BClF7O2S2 — CID 139989957
[4-(2-benzoyl-3-chlorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]sulfanium tetrafluoroborate (PubChem CID 139989957) has the molecular formula C33H23BClF7O2S2 and a molecular weight of 694.93 g/mol. Its IUPAC name is [4-(2-benzoyl-3-chlorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]sulfanium tetrafluoroborate.
| Compound Name | [4-(2-benzoyl-3-chlorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]sulfanium tetrafluoroborate |
|---|---|
| PubChem CID | 139989957 |
| Molecular Formula | C33H23BClF7O2S2 |
| Molecular Weight | 694.93 g/mol |
| Exact Mass | 694.08 |
| IUPAC Name | [4-(2-benzoyl-3-chlorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]sulfanium tetrafluoroborate |
| SMILES | COc1ccc([S+](c2ccc(Sc3cccc(Cl)c3C(=O)c3ccccc3)cc2)c2ccc(C(F)(F)F)cc2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C33H23ClF3O2S2.BF4/c1-39-24-12-18-27(19-13-24)41(26-16-10-23(11-17-26)33(35,36)37)28-20-14-25(15-21-28)40-30-9-5-8-29(34)31(30)32(38)22-6-3-2-4-7-22;2-1(3,4)5/h2-21H,1H3;/q+1;-1 |
| InChIKey | IKCRCUFWZJOCQX-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.93 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|