C28H27N3O6S3 — CID 22620004
N-benzyl-N-[[4-[2-(cyanosulfamoyl)phenyl]-2-(2-methoxyethoxy)phenyl]methyl]thiophene-2-sulfonamide (PubChem CID 22620004) has the molecular formula C28H27N3O6S3 and a molecular weight of 597.74 g/mol. Its IUPAC name is N-benzyl-N-[[4-[2-(cyanosulfamoyl)phenyl]-2-(2-methoxyethoxy)phenyl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-benzyl-N-[[4-[2-(cyanosulfamoyl)phenyl]-2-(2-methoxyethoxy)phenyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22620004 |
| Molecular Formula | C28H27N3O6S3 |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.11 |
| IUPAC Name | N-benzyl-N-[[4-[2-(cyanosulfamoyl)phenyl]-2-(2-methoxyethoxy)phenyl]methyl]thiophene-2-sulfonamide |
| SMILES | COCCOc1cc(-c2ccccc2S(=O)(=O)NC#N)ccc1CN(Cc1ccccc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C28H27N3O6S3/c1-36-15-16-37-26-18-23(25-10-5-6-11-27(25)39(32,33)30-21-29)13-14-24(26)20-31(19-22-8-3-2-4-9-22)40(34,35)28-12-7-17-38-28/h2-14,17-18,30H,15-16,19-20H2,1H3 |
| InChIKey | GOMHJYOLQRXRRO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|