C17H16ClNO3S3 — CID 26943739
5-chloro-N-[(2-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 26943739) has the molecular formula C17H16ClNO3S3 and a molecular weight of 413.97 g/mol. Its IUPAC name is 5-chloro-N-[(2-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(2-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 26943739 |
| Molecular Formula | C17H16ClNO3S3 |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | 5-chloro-N-[(2-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | COc1ccccc1CN(Cc1cccs1)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H16ClNO3S3/c1-22-15-7-3-2-5-13(15)11-19(12-14-6-4-10-23-14)25(20,21)17-9-8-16(18)24-17/h2-10H,11-12H2,1H3 |
| InChIKey | QXOCSHKSMCZSLL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |