C11H12F3NO2S — CID 22620733
2-[[2-amino-5-(trifluoromethyl)phenyl]methylsulfanyl]propanoic acid (PubChem CID 22620733) has the molecular formula C11H12F3NO2S and a molecular weight of 279.28 g/mol. Its IUPAC name is 2-[[2-amino-5-(trifluoromethyl)phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 2-[[2-amino-5-(trifluoromethyl)phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 22620733 |
| Molecular Formula | C11H12F3NO2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-[[2-amino-5-(trifluoromethyl)phenyl]methylsulfanyl]propanoic acid |
| SMILES | CC(SCc1cc(C(F)(F)F)ccc1N)C(=O)O |
| InChI | InChI=1S/C11H12F3NO2S/c1-6(10(16)17)18-5-7-4-8(11(12,13)14)2-3-9(7)15/h2-4,6H,5,15H2,1H3,(H,16,17) |
| InChIKey | BMJCJAGHQOEWMO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|