C12H15BF3NO3S — CID 23570243
N-[2-[(2-methoxy-2-oxoethyl)sulfanylmethyl]-4-(trifluoromethyl)phenyl]-methylboronamidic acid (PubChem CID 23570243) has the molecular formula C12H15BF3NO3S and a molecular weight of 321.13 g/mol. Its IUPAC name is N-[2-[(2-methoxy-2-oxoethyl)sulfanylmethyl]-4-(trifluoromethyl)phenyl]-methylboronamidic acid.
| Compound Name | N-[2-[(2-methoxy-2-oxoethyl)sulfanylmethyl]-4-(trifluoromethyl)phenyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 23570243 |
| Molecular Formula | C12H15BF3NO3S |
| Molecular Weight | 321.13 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-[2-[(2-methoxy-2-oxoethyl)sulfanylmethyl]-4-(trifluoromethyl)phenyl]-methylboronamidic acid |
| SMILES | COC(=O)CSCc1cc(C(F)(F)F)ccc1NB(C)O |
| InChI | InChI=1S/C12H15BF3NO3S/c1-13(19)17-10-4-3-9(12(14,15)16)5-8(10)6-21-7-11(18)20-2/h3-5,17,19H,6-7H2,1-2H3 |
| InChIKey | HJCQUHDBOBOEIV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.13 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|