C20H22FNO2S — CID 22622304
Benzyl 4-(3-fluoro-4-methylsulfanylphenyl)piperidine-1-carboxylate (PubChem CID 22622304) has the molecular formula C20H22FNO2S and a molecular weight of 359.50 g/mol. Its IUPAC name is benzyl 4-(3-fluoro-4-methylsulfanylphenyl)piperidine-1-carboxylate.
| Compound Name | Benzyl 4-(3-fluoro-4-methylsulfanylphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22622304 |
| Molecular Formula | C20H22FNO2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | benzyl 4-(3-fluoro-4-methylsulfanylphenyl)piperidine-1-carboxylate |
| SMILES | CSC1=C(C=C(C=C1)C2CCN(CC2)C(=O)OCC3=CC=CC=C3)F |
| InChI | InChI=1S/C20H22FNO2S/c1-25-19-8-7-17(13-18(19)21)16-9-11-22(12-10-16)20(23)24-14-15-5-3-2-4-6-15/h2-8,13,16H,9-12,14H2,1H3 |
| InChIKey | PIHKCQJHGPNCTK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | 422 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |