C17H29NO — CID 2262235
(2R,5S)-N-butyl-5-(2-methylphenoxy)hexan-2-amine (PubChem CID 2262235) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is (2R,5S)-N-butyl-5-(2-methylphenoxy)hexan-2-amine.
| Compound Name | (2R,5S)-N-butyl-5-(2-methylphenoxy)hexan-2-amine |
|---|---|
| PubChem CID | 2262235 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | (2R,5S)-N-butyl-5-(2-methylphenoxy)hexan-2-amine |
| SMILES | CCCCN[C@H](C)CC[C@H](C)Oc1ccccc1C |
| InChI | InChI=1S/C17H29NO/c1-5-6-13-18-15(3)11-12-16(4)19-17-10-8-7-9-14(17)2/h7-10,15-16,18H,5-6,11-13H2,1-4H3/t15-,16+/m1/s1 |
| InChIKey | HZERXGCDHSVEFF-CVEARBPZSA-N |
| XLogP | 4.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|