C39H48N6O3 — CID 22625826
1-[4-[4-[[bis(2-ethoxyethyl)amino]methyl]phenyl]naphthalen-1-yl]-3-[3-tert-butyl-1-(6-methyl-3-pyridinyl)pyrazol-5-yl]urea (PubChem CID 22625826) has the molecular formula C39H48N6O3 and a molecular weight of 648.85 g/mol. Its IUPAC name is 1-[4-[4-[[bis(2-ethoxyethyl)amino]methyl]phenyl]naphthalen-1-yl]-3-[3-tert-butyl-1-(6-methyl-3-pyridinyl)pyrazol-5-yl]urea.
| Compound Name | 1-[4-[4-[[bis(2-ethoxyethyl)amino]methyl]phenyl]naphthalen-1-yl]-3-[3-tert-butyl-1-(6-methyl-3-pyridinyl)pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 22625826 |
| Molecular Formula | C39H48N6O3 |
| Molecular Weight | 648.85 g/mol |
| Exact Mass | 648.38 |
| IUPAC Name | 1-[4-[4-[[bis(2-ethoxyethyl)amino]methyl]phenyl]naphthalen-1-yl]-3-[3-tert-butyl-1-(6-methyl-3-pyridinyl)pyrazol-5-yl]urea |
| SMILES | CCOCCN(CCOCC)Cc1ccc(-c2ccc(NC(=O)Nc3cc(C(C)(C)C)nn3-c3ccc(C)nc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C39H48N6O3/c1-7-47-23-21-44(22-24-48-8-2)27-29-14-16-30(17-15-29)32-19-20-35(34-12-10-9-11-33(32)34)41-38(46)42-37-25-36(39(4,5)6)43-45(37)31-18-13-28(3)40-26-31/h9-20,25-26H,7-8,21-24,27H2,1-6H3,(H2,41,42,46) |
| InChIKey | GQIFGAZKGRWEPN-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.85 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|