C33H35N5O2 — CID 91571219
1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-(3-pyridin-3-ylpropoxy)naphthalen-1-yl]urea (PubChem CID 91571219) has the molecular formula C33H35N5O2 and a molecular weight of 533.68 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-(3-pyridin-3-ylpropoxy)naphthalen-1-yl]urea.
| Compound Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-(3-pyridin-3-ylpropoxy)naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 91571219 |
| Molecular Formula | C33H35N5O2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-(3-pyridin-3-ylpropoxy)naphthalen-1-yl]urea |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(OCCCc3cccnc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C33H35N5O2/c1-23-13-15-25(16-14-23)38-31(21-30(37-38)33(2,3)4)36-32(39)35-28-17-18-29(27-12-6-5-11-26(27)28)40-20-8-10-24-9-7-19-34-22-24/h5-7,9,11-19,21-22H,8,10,20H2,1-4H3,(H2,35,36,39) |
| InChIKey | ASGRXQPKGOUDDA-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|