C31H31N5O2S — CID 70917349
1-[3-tert-butyl-1-(4-sulfanylphenyl)pyrazol-5-yl]-3-[4-(2-pyridin-4-ylethoxy)naphthalen-1-yl]urea (PubChem CID 70917349) has the molecular formula C31H31N5O2S and a molecular weight of 537.69 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-sulfanylphenyl)pyrazol-5-yl]-3-[4-(2-pyridin-4-ylethoxy)naphthalen-1-yl]urea.
| Compound Name | 1-[3-tert-butyl-1-(4-sulfanylphenyl)pyrazol-5-yl]-3-[4-(2-pyridin-4-ylethoxy)naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 70917349 |
| Molecular Formula | C31H31N5O2S |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-sulfanylphenyl)pyrazol-5-yl]-3-[4-(2-pyridin-4-ylethoxy)naphthalen-1-yl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(OCCc3ccncc3)c3ccccc23)n(-c2ccc(S)cc2)n1 |
| InChI | InChI=1S/C31H31N5O2S/c1-31(2,3)28-20-29(36(35-28)22-8-10-23(39)11-9-22)34-30(37)33-26-12-13-27(25-7-5-4-6-24(25)26)38-19-16-21-14-17-32-18-15-21/h4-15,17-18,20,39H,16,19H2,1-3H3,(H2,33,34,37) |
| InChIKey | ZJNOQXVHVXRHNX-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|